Chuỗi phương trình phản ứng hóa học

Các chuỗi phản ứng hóa học phổ biển trong chương trình phổ thông

Các phản ứng Đồng Oxit

1. Cu + 1/2O2 -> CuO

2. CuO + 2HCl -> CuCl2  + H2O

3. CuCl2 -> 1/2Cl2 + CuCl

4. 2CuCl (huyền phù) -> Cu + CuCl2

5. CuCl2 + 2H2O -> Cu(OH)2 + 2HCl

6. Cu(OH)2 + 2HNO3 -> Cu(NO3)2 + 2H2O

7. 2Cu(NO3)2 -> 2CuO + 4NO2  +O2

Xem chi tiết

Phương trình liên quan








Chuỗi phản ứng về phi kim

 

a.   Cl2 + 2Na → 2NaCl 

    2NaCl + H2SO4 đ → Na2SO4 + 2HCl 

    2HCl + CuO →CuCl2 + H2O

    2CuCl2 + 2AgNO3 → Cu(NO3)2 + 2AgCl↓ 

b.   Cl2 + H2 −a/s→ 2HCl 

    HCl + AgNO3 → AgCl↓ + HNO3

 

    2AgCl −đ/p→ 2Ag ↓ + Cl2 

    Cl2 + 2NaBr →2NaCl + Br2 

    Br2+ 2NaI → 2NaBr + I2 

c.    MnO2 + 4HCl → MnCl2 + 2H2O + Cl2 

    Cl2 + 2K → 2KCl

    2KCl + H2SO4 đ,n → K2SO4 + 2HCl↑ 

    6HCl + KClO3 → KCl + 3H2O + 3Cl2 ↑ 

    Cl2 + Ca(OH)2 → CaOCl2 + H2O

Xem chi tiết

Phương trình liên quan















Chuỗi phản ứng về halogen

a/

1. MnO2 + 4HCl → MnCl2 + Cl2 + 2H2O

2. Cl2 + SO2 + 2H2O → 2HCl + H2SO4

3. 2Na + 2HCl → 2NaCl + H2

4. 2NaCl + 2H2O → H2 ↑ + 2NaOH + Cl2

5. Cl2 + 2NaOH → NaCl + NaClO + H2O

b/

1. Fe + HCl → FeCl2 + H2

2. FeCl2 + NaOH → Fe(OH) 2 + NaCl

3. Fe(OH) 2 + 2HCl → FeCl2 + 2H2O

4. 2FeCl2 + Cl2 → 2FeCl3

5. FeCl3 + 3AgNO3 → Fe(NO3)3 + 3AgCl

Xem chi tiết

Phương trình liên quan










Chuỗi phản ứng về halogen

MnO2 + 4HCl → MnCl2 + Cl2 + 2H2 O

H2 + Cl2 → 2HCl

2KMnO4 + 16HCl → 2KCl + 2MnCl2 + 5Cl2 + 8H2 O

Ca + Cl2 → CaCl2

CaCl2 + NaOH → Ca(OH)2 + NaCl

Cl2 + Ca(OH) 2 → CaOCl2 + H2O

Xem chi tiết

Phương trình liên quan







Chuỗi phản ứng về halogen

(1 ) Cl2 + 2NaOH → NaCl + NaClO + H2O

(2) NaClO + 2HCl → NaCl + Cl2 + H2O

(3) Cl2 + Ca(OH)2 rắn → CaOCl2 + H2O

(4) CaOCl2 + 2HCl → CaCl2 + Cl2 + H2O

(5) 3Cl2 + 6KOH → 5KCl + KClO3 + 3H2O

(6) KClO3 +6HCl → 3Cl2 + KCl + 3 H2O

Xem chi tiết

Phương trình liên quan







Chuỗi phản ứng về halogen

2NaCl -đp→ 2Na + Cl2

2Na + Cl2 → 2NaCl

2Na + 2H2O → 2NaOH + H2

Cl2 + H2 → 2HCl

NaOH + HCl → NaCl + H2O

2NaOH + H2SO4 → Na2SO4 + 2H2O

2HCl + Ba(OH)2 → BaCl2 + 2H2O

Na2SO4 + BaCl2 → BaSO4↓ + 2NaCl

Xem chi tiết

Phương trình liên quan









Chuỗi phản ứng về sắt crom

   (1) 4FeS2 + 11O2 −→ 2Fe2O3 + 8SO2 ↑

    (2) Fe2O3 + 6HCl → 2FeCl3 + 3H2O

    (3) FeCl3 + 3NaOH → Fe(OH)3 + 3NaCl

    (4) 2Fe(OH)3 −→ Fe2O3 + 3H2O

    (5) Fe2O3 + H2 −→ 2FeO + H2O

    (6) FeO + H2SO4(l) → FeSO4 + H2O

    (7) FeSO4 + Mg → MgSO4 + Fe

Xem chi tiết

Phương trình liên quan








Chuỗi phản ứng về sắt crom

    (1) Cu + S −→ CuS

    (2) CuS + 14HNO3 → 3Cu(NO3)2 + 3H2SO4 + 8NO + 4H2O

    (3) Cu(NO3)2 + 2NaOH → Cu(OH)2 + 2NaNO3

    (4) Cu(OH)2 + 2HCl → CuCl2 + 2H2O

    (5) CuCl2 −đpnc→ Cu + Cl2

Xem chi tiết

Phương trình liên quan






Chuỗi phản ứng về sắt crom

    (1) Cu + S −→ CuS

    (2) CuS + 14HNO3 → 3Cu(NO3)2 + 3H2SO4 + 8NO + 4H2O

    (3) Cu(NO3)2 + 2NaOH → Cu(OH)2 + 2NaNO3

    (4) Cu(OH)2 + 2HCl → CuCl2 + 2H2O

    (5) CuCl2 −đpnc→ Cu + Cl2

Xem chi tiết

Phương trình liên quan






Chuỗi phản ứng về Amin amino axit

C2H5OOC-CH2 -CH(NH2)-CH2 -COOC2H5 + 2NaOH → NaOOC-CH2 -Cl(NH2)-CH2 -CH2 -COONa + 2C2H5OH

NaOOC-CH2-CH(NH2)-CH2-COONa + 3HCl → HOOC-CH2-CH(NH3Cl)-CH2-COOH + 2NaCl

Xem chi tiết

Phương trình liên quan

Chuỗi phản ứng về hidro sunfua lưu huỳnh

Xem chi tiết

Phương trình liên quan














Chuỗi phản ứng về oxi lưu huỳnh

Hóa học lớp 10 | Lý thuyết và Bài tập Hóa học 10 có đáp án

Xem chi tiết

Phương trình liên quan





Chuỗi phản ứng về oxi lưu huỳnh

 2KClO3Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 2KCl + 3O2

3O2Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 2O3

O3 + 2Ag → Ag2O + O2

O2 + 2Zn → 2ZnO

ZnO + H2SO4 → ZnSO4 + H2O

 

FeS + 2HCl → FeCl2 + H2S↑

2H2S + O2 thiếuHóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 2S + 2H2O

S + O2Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án SO2

SO2 + CaO → CaSO3

CaSO3 + H2SO4 → CaSO4 + H2SO4 + SO2

Xem chi tiết

Phương trình liên quan











Chuỗi phản ứng về oxi lưu huỳnh

S + O2Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án SO2

2SO2 + O2 Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 2SO3

SO3 + H2O → H2SO4

6H2SO4 đặc + 2Fe Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án Fe2 (SO4)3 + 3SO2 + 6H2O

S + H2Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án H2S↑ (A) (mùi trứng thối)

S + O2Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án SO2 (B)

 

S + Fe Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án FeS (E)

2H2S + SO2 → 3S + 2H2O

(X)⇒ S, (D) ⇒ H2O

SO2 + Br2 + 2H2O → 2HBr + H2SO4

(Y) ⇒ HBr, (Z) ⇒ H2SO4

FeS + 2HBr → FeBr2 + H2S↑

(G) ⇒ FeBr2 (A) ⇒ H2S

Hoặc FeS + H2SO4 → FeSO4+ H2S↑

(G)⇒ FeSO4 (A) ⇒ H2S

Xem chi tiết

Phương trình liên quan










Chuỗi phản ứng về oxi lưu huỳnh

ZnS + 2HCl → ZnCl2 + H2S

2H2S + O2 thiếu → 2S + 2H2O

S + O2Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án SO2

2SO2 + O2 Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 2SO3

SO3+ H2O → H2SO4

H2SO4 đặc + NaCl tinh thể → NaHSO4 + HCl

4HCl + MnO2 → Cl2 + MnCl2 + 2H2O

3Cl2 + 6KHOHóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 5KCl + KClO3 + 3H2O

2KClO3 Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 2KCl + 3O2

Xem chi tiết

Phương trình liên quan









Chuỗi phản ứng về oxi lưu huỳnh

+) S-2 → S0: 2H2S + O2 thiếu → 2S + 2H2O

+) S0 → S-2: H2 + S Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án H2S↑

+) S0 → S+4: S + O2Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án S2

+) S+4 → S0: 2H2S + SO2 → 3S + 2H2O

+) S+4 → S+6: SO2+ Br2 + 2H2O → 2HBr + H2SO4

+) S+6 → S+4: Cu + 2H2SO4 đặc Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án CuSO4 + SO2 + H2O

+) S0 → S+6: S + 3F2 → SF6

+) S+6 → S0: 3Zn + 4H2SO4 đặc Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 3ZnSO4 + S + 4H2O

+) S-2 → S+6: H2S+ 4Cl2 + 4H2O → H2SO4 + 8HCl

+) S+6 → S2-: 4Mg + 5H2SO4 đặc Hóa học lớp 10 | Lý thuyết và Bài tập Hóa 10 có đáp án 4MgSO4 + H2S + 4H2O

Xem chi tiết

Phương trình liên quan










Chuỗi phản ứng về oxi lưu huỳnh

FeS + 2HCl → FeCl2 + H2S

2H2S + O2thiếu ---V2O5→ 2S + 2H2O

SO2 + CaO → CaSO3

CaSO3 + H2SO4 → CaSO4 + SO2 + H2O

Xem chi tiết

Phương trình liên quan





Chuỗi phản ứng về oxi lưu huỳnh

FeS + 2HCl → FeCl2 + H2S↑

(A)        (C)        (B)

H2S + CuSO4 → CuS↓ + H2SO4

                            (D)       (E)

2H2S + SO2 → 2S↓ + 2H2O

            (F)       (G)        (H)

2FeCl2 + Cl2 → 2FeCl3

               (J)       (L)

2FeCl3 + 2KI → 2FeCl2 + 2KCl + I2

                                          (M)     (N)

Xem chi tiết

Phương trình liên quan





Chuỗi phản ứng về oxi lưu huỳnh

S + O2 → SO2 (A)

Hóa học lớp 10 | Lý thuyết và Bài tập Hóa học 10 có đáp án

SO3 + H2O → H2SO4

6H2SO4(đ) + 2Fe → Fe2(SO4)3 + 3SO2 + 6H2O

Xem chi tiết

Phương trình liên quan




Chuỗi phản ứng về oxi lưu huỳnh

2KMnO4 + 16HCl → 2KCl + 2MnCl2 + 5Cl2 + 8H2O

3Cl2 + 6NaOH → 5NaCl + NaClO3 + 3H2O

2NaClO3 → 2NaCl + 3O2

O2 + S → SO2

Hóa học lớp 10 | Lý thuyết và Bài tập Hóa học 10 có đáp án

SO3 + H2O → H2SO4

Xem chi tiết

Phương trình liên quan






chuỗi phản ứng

Xem chi tiết

Phương trình liên quan



Chuỗi phản ứng về hợp chất lưu huỳnh, sắt

a, 1. MnO2 + 4HCl → MnCl2 + Cl2 + 2H2O

2. Cl2 + SO2 + 2H2O → 2HCl + H2SO4

3. 2Na + 2HCl → 2NaCl + H2

4. 2NaCl + 2H2O → H2 ↑ + 2NaOH + Cl2

5. Cl2 + 2NaOH → NaCl + NaClO + H2O

b, 1. Fe + HCl → FeCl2 + H2

2. FeCl2 + NaOH → Fe(OH) 2 + NaCl

3. Fe(OH) 2 + 2HCl → FeCl2 + 2H2O

4. 2FeCl2 + Cl2 → 2FeCl3

5. FeCl3 + 3AgNO3 → Fe(NO3)3 + 3AgCl

Xem chi tiết

Phương trình liên quan











Chuỗi phản ứng về halogen

a, MnO2 + 4HCl → MnCl2 + Cl2 + 2H2 O

H2 + Cl2 → 2HCl

2KMnO4 + 16HCl → 2KCl + 2MnCl2 + 5Cl2 + 8H2 O

Ca + Cl2 → CaCl2

CaCl2 + NaOH → Ca(OH)2 + NaCl

Cl2 + Ca(OH) 2 → CaOCl2 + H2O

b, 2KMnO4 + 16HCl → 2KCl + 2MnCl2 + 5Cl2 + 8H2O

Cl2 + 2K → 2 KCl

2KCl → 2K + Cl2

Cl + H2 O → HCl+ HClO

Cl2 + 2NaOH → NaCl + NaClO + H2O

NaClO + 2HCl → Cl2 + NaCl + H2O

2NaCl + 2H2O → H2 + 2NaOH + Cl2

2Fe + 3Cl2 → 2FeCl3

Xem chi tiết

Phương trình liên quan














Chuỗi phản ứng

Xem chi tiết

Phương trình liên quan









Chuỗi phản ứng về phi kim

a.   Cl2 + 2Na → 2NaCl 

    2NaCl + H2SO4 đ → Na2SO4 + 2HCl 

    2HCl + CuO →CuCl2 + H2O

    2CuCl2 + 2AgNO3 → Cu(NO3)2 + 2AgCl↓ 

b.   Cl2 + H2 −a/s→ 2HCl 

    HCl + AgNO3 → AgCl↓ + HNO3

    2AgCl −đ/p→ 2Ag ↓ + Cl2 

    Cl2 + 2NaBr →2NaCl + Br2 

    Br2+ 2NaI → 2NaBr + I2 

c.    MnO2 + 4HCl → MnCl2 + 2H2O + Cl2 

    Cl2 + 2K → 2KCl

    2KCl + H2SO4 đ,n → K2SO4 + 2HCl↑ 

    6HCl + KClO3 → KCl + 3H2O + 3Cl2 ↑ 

    Cl2 + Ca(OH)2 → CaOCl2 + H2O

Xem chi tiết

Phương trình liên quan















Chuỗi phản ứng về kim loại

CaCO3 to→ CaO + CO2

CaO + H2O → Ca(OH)2

Ca(OH)2 + CO2 → CaCO3 + H2O

CaCO3 + CO2 + H2O → Ca(HCO3)2

Ca(HCO3)2 + Na2CO3 → 2NaHCO3 + CaCO3

NaHCO3 + HCl → NaCl + CO2 + H2O

Xem chi tiết

Phương trình liên quan







Chuỗi phản ứng về kim loại

4Al + 3O2 to→ 2Al2O3

Al2O3 + 6HCl → 2AlCl3 + 3H2O

AlCl3 + 3NaOH → Al(OH)3 + 3NaCl

2Al(OH)3 to→ Al2O3 + 3H2O

2Al2O3 đpnc→ 4Al + 3O2

Xem chi tiết

Phương trình liên quan






Chuỗi phản ứng về kim loại

3Fe + 2O2 to→ Fe3O4

Fe3O4 + 8HCl → FeCl2 + 2FeCl3 + 4H2O

FeCl3 + 3NaOH → Fe(OH)3 + 3NaCl

2Fe(OH)3 to→ Fe2O3 + 3H2O

Fe2O3 + 3CO to→ 2Fe + 3CO2

Fe + CuCl2 → Cu + FeCl2

Xem chi tiết

Phương trình liên quan







Chuỗi phản ứng về phi kim

S + O2 to→ SO2

2SO2 + O2 to→ 2SO3

SO3 + H2O → H2SO4

H2SO4 + 2NaOH → Na2SO4 + 2H2O

Na2SO4 + BaCl2 → BaSO4 + 2NaCl

Xem chi tiết

Phương trình liên quan





Chuỗi phản ứng phản ứng hóa học

Đề kiểm tra Hóa học 8

Xem chi tiết

Phương trình liên quan





Chuỗi phản ứng vô cơ

1) 2Cu + O2 \overset{t^{\circ } }{\rightarrow} 2CuO

2) CuO + H2SO4 → CuSO4 + H2O

3) CuSO4 + BaCl2 → BaSO4 + CuCl2

4) CuCl2 + 2NaOH → Cu(OH)2 + 2NaCl

5) 3Cu(OH)2 + 2Fe(NO3)3 → 3Cu(NO3)2 + 2Fe(OH)3

6) Cu(NO3)2 + Zn → Zn(NO3)2 + Cu

Xem chi tiết

Phương trình liên quan






Chuỗi phản ứng vô cơ

1) 4Al + 3O2 → 2Al2O3

2) Al2O3 + 2NaOH → 2NaAlO2 + H2O

3) NaAlO2 + 2H2O → NaOH + Al(OH)3

4) 2Al(OH)3 + 3ZnSO4 → Al2(SO4)3 + 3Zn(OH)2

5) Al2(SO4)3 + 3BaCl2 → 2AlCl3 + 3BaSO4

6) AlCl3 + 3AgNO3 → Al(NO3)3 + 3AgCl

Xem chi tiết

Phương trình liên quan







Chuỗi phản ứng vô cơ

1) 4FeS2 + 11O→ 2Fe2O3 + 8SO2

2) 2SO2 + O2 → 2SO3

3) SO3 + H2O → H2SO4

4) H2SO4 +Zn → ZnSO4 + H2

5) ZnSO4 + 2NaOH → Zn(OH)2 + Na2SO4

6) Zn(OH)2 → ZnO + H2O

Xem chi tiết

Phương trình liên quan






Chuỗi phản ứng vô cơ

1) S + O2 → SO2

2) SO2 + Br2 + 2H2O → H2SO4 + 2HBr

3) 2H2SO4 + Cu → CuSO4 + SO2 + 2H2O

4) SO2 + KOH → K2SO3 + H2O

Xem chi tiết

Phương trình liên quan





Chuỗi phản ứng vô cơ

CaCO3 → CaO + CO2 

CaO + H2O → Ca(OH)2

Ca(OH)2 + CO2 → CaCO3 + H2O

CaCO3 + H2O + CO2 →Ca(HCO3)2

Ca(HCO3)2 \overset{t^{\circ } }{\rightarrow} Ca(OH)2 + H2O + CO2

Xem chi tiết

Phương trình liên quan






Chuỗi phản ứng vô cơ

1) 2Na + 2H2O → 2NaOH + H2

2) 2NaOH + CO2 → Na2CO3 + H2O

3) Na2CO3 + CO2 + H2O → 2NaHCO3

4) 2NaHCO3 + Ca(OH)2 → CaCO3 + 2NaOH + 2H2O

5) NaOH + HCl → NaCl + H2O

6) 2NaCl + 2H2O → 2NaOH + Cl2 + H2

7) 4NaOH → 4Na + O2 + 2H2O

8) 2Na + H2 → 2NaH

9) NaH + H2O → NaOH + H2

Xem chi tiết

Phương trình liên quan










Chuỗi phản ứng vô cơ

1) 4Al + 3O\overset{t^{\circ } }{\rightarrow} 2Al2O3

2) Al2O3 + 6HNO3 → 2Al(NO3)3 + 3H2O

3) Al(NO3)3 + 3NH3 + 3H2O → Al(OH)3 + 3NH4NO3

4) Al(OH)3 + NaOH → Na[Al(OH)4]

5) K[Al(OH)4] + CO2 → Al(OH)3 + KHCO3

6) 2Al(OH)3 → 2Al2O3 + 3H2O

7) Al2O3 + 2NaOH + 3H2O → 2Na[Al(OH)4]

8) 2K[Al(OH)4] + 4H2SO4 → Al2(SO4)3 + K2SO4 + 4H2O

9) Al2(SO4)3 + K2SO4 + 24H2O → 2KAl(SO4)2.12H2O

Xem chi tiết

Phương trình liên quan










Chuỗi phản ứng về cao su buna

(1) CaC2 + H2O → C2H2 + Ca(OH)2

điều-chế-cao-su-buna

Xem chi tiết

Phương trình liên quan





Chuỗi phản ứng về axit acetic

điều-chế-các-đồng-phân-axit-của-C2H4O2

Xem chi tiết

Phương trình liên quan




Fe + 2HCl --> FeCl2 + H2

3Fe + 2Cl2  --> 2FeCl3

2FeCl3 + Fe --> 3FeCl2

FeCl2 + 2NaOH --> Fe(OH)2 + 2NaCl

Fe(OH)2 + O2 + 2H2O --> 4Fe(OH)3

Fe2O3 + CO --> 2FeO + CO2

FeO + CO --> Fe + CO2

 

 

 

 

Xem chi tiết

Phương trình liên quan








Chia sẻ là yêu thương

Ngoài ra, một trong những cách đơn giản nhất là bạn Like và Share trang Facebook của chúng mình.



Nhân quả trong cuộc sống Tranh nhân quả, nhân Tôn trọng mọi người. quả tài năng của thiên hạ dồn về mình.

Doanh thu từ quảng cáo giúp chúng mình duy trì nội dung chất lượng cho website - vì sao chúng mình phải đặt quảng cáo ? :D

Tôi không muốn hỗ trợ Từ Điển (Đóng) - :(