nCH2=CH-CH=CH2(-CH2-CH=CH-CH2-)n
(khí) (rắn)
(không màu)
n 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Điều kiện phản ứng

Nhiệt độ: t0 Xúc tác: xt, p

Cách thực hiện phản ứng

trùng hợp cao butadien.

Câu hỏi minh họa


Câu 1. Xác định chất

Xác định các chất C biết A, B, C, D… là các chất vô cơ hoặc hữu cơ thỏa mãn: A (600 đô C)→ B + C; B + H2O → D; E + F → A; 2D → (xt,t0) E + F + 2H2O; n E →( to, p, xt) Cao su Buna.


A. C2H5OH
B. CH3CHO
C. C2H6
D. C6H6

Xem đáp án câu 1

Câu 2. Điều chế cao su buna

Có thể điều chế cao su Buna (X) từ các nguồn thiên nhiên theo các sơ đồ sau. Hãy chỉ ra sơ đồ sai.


A. Tinh bột → glucozơ → C2H5OH → Buta-1,3-đien→ X.
B. Xenlulozơ → glucozơ → C2H4 → C2H5OH → Buta-1,3-đien → X.
C. CH4 → C2H2 →C4H4 → Buta-1,3-đien → X.
D. CaCO3 → CaO → CaC2 → C2H2 →C4H4 → Buta-1,3-đien → X.

Xem đáp án câu 2

Đóng góp nội dung

Nếu thấy phương trình này còn thiếu nội dung, bạn hãy điền vào form này, chúng mình sẽ xem và thêm nội dung vào trong thời gian sớm nhất.



2C2H5OHC4H6 + H2 + H2O
(lỏng) (khí) (khí) (lỏng)
(không màu) (không màu) (không màu) (không màu)
2 1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Điều kiện phản ứng

Nhiệt độ: 450 độ C Xúc tác: Al2O3, Cr2O3

Cách thực hiện phản ứng

nung nóng C2H5OH ở 450 độ C.

Hiện tượng nhận biết

có khí thoát ra.

Đóng góp nội dung

Nếu thấy phương trình này còn thiếu nội dung, bạn hãy điền vào form này, chúng mình sẽ xem và thêm nội dung vào trong thời gian sớm nhất.



2H2 + CH2=CH-CH=CH2CH3CH2CH2CH3
(khí) (khí) (khí)
(không màu) (không màu) (không màu)
2 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Điều kiện phản ứng

Nhiệt độ: Nhiệt độ Xúc tác: Ni

Cách thực hiện phản ứng

hidro hóa butadien.

Câu hỏi minh họa


Câu 1. Hidrocacbon

Cho các chất: buta-1,3- đien, benzen, ancol anlylic, anđehit axetic, axit acrylic, vinylaxetat. Khi cho các chất đó cộng H2 dư (xúc tác Ni,to) thu được sản phẩm hữu cơ, đốt cháy sản phẩm hữu cơ này cho số mol H2O lớn hơn số mol CO2. Số chất thỏa mãn là:


A. 6
B. 3
C. 4
D. 5

Xem đáp án câu 1

Đóng góp nội dung

Nếu thấy phương trình này còn thiếu nội dung, bạn hãy điền vào form này, chúng mình sẽ xem và thêm nội dung vào trong thời gian sớm nhất.



Xin bạn hãy tắt phần mềm chặn quảng cáo - vì sao chúng mình phải đặt quảng cáo ? :D