Advertisement

Chủ đề: Phương trình hóa học hữu cơ - Trang 2

Tất cả những phương trình hữu cơ hiện có trên Từ Điển Phương Trình Hóa Học - Cập nhật 2022

Định nghĩa phân loại

Phương trình số #2

NaOH + KHS → KOH + NaHS

Không có

Xem trạng thái chất và chi tiết của phương trình NaOH + KHS => KOH + NaHS  

Phương trình số #3

NaOH + C2H5COOH → H2O + C2H5COONa

Không có

Xem trạng thái chất và chi tiết của phương trình NaOH + C2H5COOH => H2O + C2H5COONa  

Phương trình số #4

3Br2 + C6H5OH → 3HBr + (Br)3C6H2OH

Không có

Xem trạng thái chất và chi tiết của phương trình Br2 + C6H5OH => HBr + (Br)3C6H2OH  

Phương trình số #5

Fe2(SO4)3 + 3H2O → 2Fe + 3H2SO4 + 3/2O2

Điều kiện khác: điện phân dd

Xem trạng thái chất và chi tiết của phương trình Fe2(SO4)3 + H2O => Fe + H2SO4 + O2  

Phương trình số #6

3Cu + 4H2SO4 + 2NaNO34H2O + Na2SO4 + 2NO + 3CuSO4

Không có

Xem trạng thái chất và chi tiết của phương trình Cu + H2SO4 + NaNO3 => H2O + Na2SO4 + NO + CuSO4  

Phương trình số #7

nCH2=CHCH=CH2 + nCH(C6H5)=CH2(-CH2 - CH = CH - CH2 - CH(C6H5) - CH2 - )n

Nhiệt độ: t0 Xúc tác: xt, p, Na

Xem trạng thái chất và chi tiết của phương trình CH2=CHCH=CH2 + CH(C6H5)=CH2 => (-CH2 - CH = CH - CH2 - CH(C6H5) - CH2 - )n  

Phương trình số #8

O2 + 2CH2=CH22CH3CHO

Xúc tác: PdCl2, CuCl2.

Xem trạng thái chất và chi tiết của phương trình O2 + CH2=CH2 => CH3CHO  

Phương trình số #9

nCH2=CH-CH=CH2(-CH2-CH=CH-CH2-)n

Nhiệt độ: t0 Xúc tác: xt, p

Xem trạng thái chất và chi tiết của phương trình CH2=CH-CH=CH2 => (-CH2-CH=CH-CH2-)n  

Phương trình số #10

2C2H5OH → C4H6 + H2 + H2O

Nhiệt độ: 450 độ C Xúc tác: Al2O3, Cr2O3

Xem trạng thái chất và chi tiết của phương trình C2H5OH => C4H6 + H2 + H2O  


Khám Phá Tin Tức Thú Vị Chỉ 5% Người Biết

Cập Nhật 2022-08-09 04:09:54am


Doanh thu từ quảng cáo giúp chúng mình duy trì nội dung chất lượng cho website - vì sao chúng mình phải đặt quảng cáo ? :D

  Cách tắt chặn quảng cáo  

Tôi không muốn hỗ trợ Từ Điển (Đóng) - :(