Advertisement

Tìm kiếm phương trình hóa học
Hãy nhập vào chất tham gia hoặc/và chất sản phẩm để bắt đầu tìm kiếm

Nhóm Học Miễn Phí Online Facebook
Lưu ý: mỗi chất cách nhau 1 khoảng trắng, ví dụ: H2 O2

Tổng hợp đầy đủ phương trình có K2SO4 là chất tham gia

Tất cả các phương trình đã cân bằng có K2SO4 (Kali sunfat) là chất tham gia, đầy đủ và chi tiết nhất. Cân bằng phương trình phản ứng hóa học. Phản ứng oxi hóa khử

Những Điều Thú Vị Chỉ 5% Người Biết

Advertisement

Phương trình số #2

Ba(OH)2 + K2SO42KOH + BaSO4

Không có

Xem trạng thái chất và chi tiết của phương trình Ba(OH)2 + K2SO4 => KOH + BaSO4  

Phương trình số #3

BaCl2 + K2SO42KCl + BaSO4

Không có

Xem trạng thái chất và chi tiết của phương trình BaCl2 + K2SO4 => KCl + BaSO4  

Phương trình số #4

2AgNO3 + K2SO42KNO3 + Ag2SO4

Nhiệt độ: nhiệt độ

Xem trạng thái chất và chi tiết của phương trình AgNO3 + K2SO4 => KNO3 + Ag2SO4  

Phương trình số #5

2Al(OH)3 + 3K2SO4Al2(SO4)3 + 6KOH

Không có

Xem trạng thái chất và chi tiết của phương trình Al(OH)3 + K2SO4 => Al2(SO4)3 + KOH  

Phương trình số #6

Al2(SO4)3 + 24H2O + K2SO42KAl(SO4)2.12H2O

Không có

Xem trạng thái chất và chi tiết của phương trình Al2(SO4)3 + H2O + K2SO4 => KAl(SO4)2.12H2O  

Phương trình số #7

24H2O + K2SO4 + Cr2(SO4)3K2SO4.Cr2(SO4)3.24H2O

Không có

Xem trạng thái chất và chi tiết của phương trình H2O + K2SO4 + Cr2(SO4)3 => K2SO4.Cr2(SO4)3.24H2O  

Phương trình số #8

3K2SO4 + 2AlBr3Al2(SO4)3 + 6KBr

Nhiệt độ: nhiệt độ

Xem trạng thái chất và chi tiết của phương trình K2SO4 + AlBr3 => Al2(SO4)3 + KBr  

Phương trình số #9

4H2 + K2SO44H2O + K2S

Nhiệt độ: 600°C Dung môi: Fe2O3

Xem trạng thái chất và chi tiết của phương trình H2 + K2SO4 => H2O + K2S  

Phương trình số #10

Ba(OH)2 + K2SO42KOH + BaSO4

Không có

Xem trạng thái chất và chi tiết của phương trình Ba(OH)2 + K2SO4 => KOH + BaSO4  


Khám Phá Tin Tức Thú Vị Chỉ 5% Người Biết

Cập Nhật 2022-07-03 01:14:54pm


Doanh thu từ quảng cáo giúp chúng mình duy trì nội dung chất lượng cho website - vì sao chúng mình phải đặt quảng cáo ? :D

  Cách tắt chặn quảng cáo  

Tôi không muốn hỗ trợ Từ Điển (Đóng) - :(