Advertisement

Tìm kiếm phương trình hóa học
Hãy nhập vào chất tham gia hoặc/và chất sản phẩm để bắt đầu tìm kiếm

Nhóm Học Miễn Phí Online Facebook
Lưu ý: mỗi chất cách nhau 1 khoảng trắng, ví dụ: H2 O2

Tổng hợp đầy đủ phương trình có H2 là chất tham gia

Tất cả các phương trình đã cân bằng có H2 (hidro) là chất tham gia, đầy đủ và chi tiết nhất. Cân bằng phương trình phản ứng hóa học. Phản ứng oxi hóa khử

Những Điều Thú Vị Chỉ 5% Người Biết

Advertisement

Phương trình số #2

CO + 2H2CH3OH

Nhiệt độ: 250 - 300°C Áp suất: 300 Xúc tác: CuO/Cr2O3

Xem trạng thái chất và chi tiết của phương trình CO + H2 => CH3OH  

Phương trình số #3

C6H12O6 + H2C6H14O6

Nhiệt độ: t0 Xúc tác: Ni

Xem trạng thái chất và chi tiết của phương trình C6H12O6 + H2 => C6H14O6  

Phương trình số #4

H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3CH3(CH2)16CO2CH3

Nhiệt độ: nhiệt độ Xúc tác: Ni

Xem trạng thái chất và chi tiết của phương trình H2 + CH3(CH2)7CH=CH(CH2)7CO2CH3 => CH3(CH2)16CO2CH3  

Phương trình số #5

H2 + 2K → 2KH

Nhiệt độ: 200 - 350°C

Xem trạng thái chất và chi tiết của phương trình H2 + K => KH  

Phương trình số #6

H2 + 2Na → 2NaH

Nhiệt độ: 250-400, áp suất

Xem trạng thái chất và chi tiết của phương trình H2 + Na => NaH  

Phương trình số #7

6H2 + (C17H31COO)3C3H5(C17H35COO)3C3H5

Nhiệt độ: Ni, t0

Xem trạng thái chất và chi tiết của phương trình H2 + (C17H31COO)3C3H5 => (C17H35COO)3C3H5  

Phương trình số #8

CH3Cl + H2CH4 + HCl

Xúc tác: Pd/C

Xem trạng thái chất và chi tiết của phương trình CH3Cl + H2 => CH4 + HCl  

Phương trình số #9

3H2 + C6H5NO2C6H5NH2 + 2H2O

Xúc tác: Ni

Xem trạng thái chất và chi tiết của phương trình H2 + C6H5NO2 => C6H5NH2 + H2O  

Phương trình số #10

H2 + N2O → H2O + N2

Nhiệt độ: 150 - 200°C

Xem trạng thái chất và chi tiết của phương trình H2 + N2O => H2O + N2  


Khám Phá Tin Tức Thú Vị Chỉ 5% Người Biết

Cập Nhật 2022-08-14 01:47:40am


Doanh thu từ quảng cáo giúp chúng mình duy trì nội dung chất lượng cho website - vì sao chúng mình phải đặt quảng cáo ? :D

  Cách tắt chặn quảng cáo  

Tôi không muốn hỗ trợ Từ Điển (Đóng) - :(