English Version

Br2 + C6H5CHCH2C6H5-CH(Br)-CH2Br
(dung dịch) (lỏng) (dd)
(không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Điều kiện phản ứng

Không có

Cách thực hiện phản ứng

cho stiren tác dụng với brom.

Hiện tượng nhận biết

stiren làm brom mất màu.

Câu hỏi minh họa

Câu 1. Chất tác dụng với H2 và làm mất màu Br2,

Cho các chất sau đây: propen, isobutan, propanal, stiren, toluen, axit
acrylic, glucozơ. Số chất vừa làm mất màu nước brom, vừa tác dụng với H2
(trong những điều kiện thích hợp) là


A. 6
B. 4
C. 7
D. 5

Xem đáp án câu 1

Câu 2. Phản ứng

Có bao nhiêu phản ứng trong các phương trình sau tạo ra chất khí?
Al(OH)3 + H2SO4 ----> ;
C6H5CH(CH3)2 ---t0--> ;
Mg + BaSO4 --> ;
AgNO3 + H2O + NH3 + C2H5CHO ---> ;
H2SO4 + K ----> ;
H2O + NH3 + CuSO4 ---> ;
NaHSO3 + NaHSO4 ----> ;
(NH2)2CO + NaOH ----> ;
NaOH + SiO2 ---> ;
HCl + NH4HSO3 ---> ;
CO + Fe3O4 ----> ;
Ba(HCO3)2 ---t0----> ;
S + Zn ---> ;
Br2 + C6H5CHCH2 ---> ;
CH3COOC2H5 ---t0---> ;
Na + NaOH ----> ;
CH3COOH + KHCO3 ---> ;
Cu + H2O + O2 --->




A. 5
B. 7
C. 10
D. 12

Xem đáp án câu 2

Đóng góp nội dung

Nếu thấy phương trình này còn thiếu nội dung, bạn hãy điền vào form này, chúng mình sẽ xem và thêm nội dung vào trong thời gian sớm nhất.


Xin bạn hãy tắt phần mềm chặn quảng cáo - vì sao chúng mình phải đặt quảng cáo ? :D