Định nghĩa phân loại phương trình


C6H5CH2OHPh-COOH
(lỏng) (lỏng)
(không màu) (không màu)
1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Điều kiện phản ứng

Điều kiện khác: KMnO4 đặc, heat; H+

Cách thực hiện phản ứng

cho C6H5CH2OH qua KMnO4đ, H+.

Đóng góp nội dung

Nếu thấy phương trình này còn thiếu nội dung, bạn hãy điền vào form này, chúng mình sẽ xem và thêm nội dung vào trong thời gian sớm nhất.



Br2 + CH2=CH-COOHCH2(Br)-CH(Br)-COOH
(lỏng) (lỏng) (lỏng)
(nâu đỏ) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Điều kiện phản ứng

Không có

Cách thực hiện phản ứng

cho acid acrylic tác dụng với dd Br2.

Câu hỏi minh họa

Câu 1. Chất lưỡng tính

Chất nào sau đây vừa tác dụng được với dung dịch NaOH, vừa tác dụng được với nước Br2?


A. CH3CH2CH2OH
B. CH3CH2COOH
C. CH2=CHCOOH
D. CH3COOCH3

Xem đáp án câu 1

Đóng góp nội dung

Nếu thấy phương trình này còn thiếu nội dung, bạn hãy điền vào form này, chúng mình sẽ xem và thêm nội dung vào trong thời gian sớm nhất.



2NaOH + K2HPO42KOH + Na2HPO4
(dung dịch) (rắn) (dung dịch) (rắn)
(không màu) (trắng) (không màu)
2 1 2 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)

Điều kiện phản ứng

Điều kiện khác: tỉ lệ mol 1:2

Cách thực hiện phản ứng

cho K2HPO4 tác dụng với NaOH theo tỉ lệ 1:2.

Câu hỏi minh họa

Câu 1. Chất lưỡng tính

Cho dãy các chất: NaOH, Sn(OH)2, Pb(OH)2, Al(OH)3, Cr(OH)3, Cr2O3, (NH4)2CO3, K2HPO4.
Số chất trong dãy có tính chất lưỡng tính là:


A. 4
B. 5
C. 6
D. 7

Xem đáp án câu 1

Câu 2. đơn chất

Cho các phương trình phản ứng hóa học sau:
H2O + K2CO3 + FeCl3 ---> ;
CH3I + C2H5NH2 ---> ;
Br2 + C6H6 ---> ;
Br2 + H2O + CH3CH2CH=O ---> ;
NaHCO3 + C2H5COOH ---> ;
NaOH + HCOONH3CH2CH3 ---> ;
Br2 + KI ---> ;
H2O + KCl ---> ;
S + CrO3 ----> ;
FeCl2 + H2O ----> ;
AlCl3 ---t0--> ;
H2SO4 + KMnO4 + H2C2O4 ---> ;
AgNO3 + C6H12O6 + H2O + NH3 --->
O2 + C4H10 --> ;
Ba(OH)2 + Cr(NO3)3 ---> ;
NaOH + K2HPO4 ---> ;
NaOH + C2H5Cl ---> ;
H2SO4 + Fe(OH)2 ---> ;
Cu + H2SO4 + NaNO3 ---> ;
F2 + H2 ---> ;
Fe2O3 + H2 ---> ;
CaO + HCl ---> ;
KOH + CH3NH3HCO3 ---> ;
C + ZnO ---> ;
Zn + BaSO4 ---> ;
Na2SO3 + Ba(OH)2 ---> ;
H2 + O2 ---> ;
NaOH + CuCl2 ---> ;
Al + H2O ---> ;
NaOH + CH3COOK ---> ;
Mg + CO2 ---> ;
Fe + H2O ---> ;
Ca(OH)2 + SO2 ---> ;
BaO + CO2 ---> ;
FeCl2 + Zn ----> ;
NaOH --dpnc--> ;
Trong các phương trình phản ứng trên, có bao nhiêu phương trình tạo ra đơn chất?


A. 26
B. 18
C. 24
D. 12

Xem đáp án câu 2

Đóng góp nội dung

Nếu thấy phương trình này còn thiếu nội dung, bạn hãy điền vào form này, chúng mình sẽ xem và thêm nội dung vào trong thời gian sớm nhất.



Xin bạn hãy tắt phần mềm chặn quảng cáo - vì sao chúng mình phải đặt quảng cáo ? :D