CH3(CH2)7CH=CH(CH2)7COOCH3 + H2CH3(CH2)16COOCH3
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)
Nhiệt độ: nhiệt độ Xúc tác: Ni
CH3COOH + (CH3)2CHCH2CH2OHH2O + CH3COOCH2CH2CH(CH3)2
1 1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)
Nhiệt độ: nhiệt độ Điều kiện khác: H2SO4

Xin bạn hãy tắt phần mềm chặn quảng cáo - vì sao chúng mình phải đặt quảng cáo ? :(