Br2 + CH2=CH-COOHCH2(Br)-CH(Br)-COOH
(lỏng) (lỏng) (lỏng)
(nâu đỏ) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)
Không có
cho acid acrylic tác dụng với dd Br2.

Câu 1. Chất lưỡng tính

Chất nào sau đây vừa tác dụng được với dung dịch NaOH, vừa tác dụng được với nước Br2?


A. CH3CH2CH2OH
B. CH3CH2COOH
C. CH2=CHCOOH
D. CH3COOCH3

Xem đáp án
2NaOH + K2HPO42KOH + Na2HPO4
(dung dịch) (rắn) (dung dịch) (rắn)
(không màu) (trắng) (không màu)
2 1 2 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)
Điều kiện khác: tỉ lệ mol 1:2
cho K2HPO4 tác dụng với NaOH theo tỉ lệ 1:2.

Câu 1. Chất lưỡng tính

Cho dãy các chất: NaOH, Sn(OH)2, Pb(OH)2, Al(OH)3, Cr(OH)3, Cr2O3, (NH4)2CO3, K2HPO4. Số chất trong dãy có tính chất lưỡng tính là:


A. 4
B. 5
C. 6
D. 7

Xem đáp án

Xin bạn hãy tắt phần mềm chặn quảng cáo - vì sao chúng mình phải đặt quảng cáo ? :(