7H2SO4 + K2Cr2O7 + 6KI7H2O + 3I2 + 4K2SO4 + Cr2(SO4)3
(dung dịch) (dung dịch) (rắn) (lỏng) (rắn) (rắn) (dung dịch)
(không màu) (vàng cam) (trắng) (không màu) (đen tím) (trắng) (xanh lục)
7 1 6 7 3 4 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)
Không có
cho K2Cr2O7 tác dụng với dung dịch KI trong môi trường axit.
Dung dịch mất màu vàng cam (của K2Cr2O7), chuyển sang màu xanh lục (của Cr2(SO4)3).
H2 + CH3[CH2]7CH=CH[CH2]7COOCH3CH3[CH2]16COOCH3
(khí) (rắn) (rắn)
(không màu) (không màu) (không màu)
1 1 1 Hệ số
Nguyên - Phân tử khối (g/mol)
Số mol
Khối lượng (g)
Nhiệt độ: nhiệt độ cao Áp suất: 1 Xúc tác: Ni
Cho metyl oleat tác dụng với H2
Liên kết đôi bị phá vỡ

Xin bạn hãy tắt phần mềm chặn quảng cáo - vì sao chúng mình phải đặt quảng cáo ? :(